ChemNet > CAS > 321309-31-3 2,1,3-benzothiadiazole-5-carbonyl chloride
321309-31-3 2,1,3-benzothiadiazole-5-carbonyl chloride
Название продукта |
2,1,3-benzothiadiazole-5-carbonyl chloride |
Молекулярная формула |
C7H3ClN2OS |
Молекулярный вес |
198.6295 |
InChI |
InChI=1/C7H3ClN2OS/c8-7(11)4-1-2-5-6(3-4)10-12-9-5/h1-3H |
Регистрационный номер CAS |
321309-31-3 |
Молекулярная структура |
|
Плотность |
1.577g/cm3 |
Температура плавления |
113℃ |
Точка кипения |
297.6°C at 760 mmHg |
Показатель преломления |
1.704 |
Температура вспышки |
133.8°C |
Символы опасности |
C:Corrosive;
|
Риск коды |
R34:Causes burns.;
|
Характеристики безопасности |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|